C24H37N5O — CID 111806060
N'-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N-phenylpiperidine-1-carboximidamide (PubChem CID 111806060) has the molecular formula C24H37N5O and a molecular weight of 411.59 g/mol. Its IUPAC name is N'-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111806060 |
| Molecular Formula | C24H37N5O |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | N'-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-N-phenylpiperidine-1-carboximidamide |
| SMILES | O=C(C1CCCC1)N1CCN(CC/N=C(\Nc2ccccc2)N2CCCCC2)CC1 |
| InChI | InChI=1S/C24H37N5O/c30-23(21-9-5-6-10-21)28-19-17-27(18-20-28)16-13-25-24(29-14-7-2-8-15-29)26-22-11-3-1-4-12-22/h1,3-4,11-12,21H,2,5-10,13-20H2,(H,25,26) |
| InChIKey | KVKSTFRRDAKPNR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|