About 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole
3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole (PubChem CID 11180628) has the molecular formula C23H14Br3N3
and a molecular weight of 572.10 g/mol. Its IUPAC name is 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole.
Molecular Properties
| Compound Name | 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole |
| PubChem CID | 11180628 |
| Molecular Formula | C23H14Br3N3 |
| Molecular Weight | 572.10 g/mol |
| Exact Mass | 568.87 |
| IUPAC Name | 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole |
| SMILES | Brc1ccc(-c2nc(-c3c[nH]c4ccc(Br)cc34)[nH]c2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H14Br3N3/c24-15-5-1-13(2-6-15)21-22(14-3-7-16(25)8-4-14)29-23(28-21)19-12-27-20-10-9-17(26)11-18(19)20/h1-12,27H,(H,28,29) |
| InChIKey | RTCNGZPSDNORKU-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.10 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole?
The IUPAC name of 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole (CID 11180628) is 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole.
What is the SMILES notation for 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole?
The canonical SMILES for 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole is Brc1ccc(-c2nc(-c3c[nH]c4ccc(Br)cc34)[nH]c2-c2ccc(Br)cc2)cc1.
What is the InChIKey of 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole?
The InChIKey is RTCNGZPSDNORKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Br3N3/c24-15-5-1-13(2-6-15)21-22(14-3-7-16(25)8-4-14)29-23(28-21)19-12-27-20-10-9-17(26)11-18(19)20/h1-12,27H,(H,28,29).
What are the key properties of 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole?
3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole has a molecular weight of 572.10 g/mol, XLogP of 8.18, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4,5-bis(4-bromophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole is sourced from PubChem (CID 11180628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).