C22H32IN3O3 — CID 111806327
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111806327) has the molecular formula C22H32IN3O3 and a molecular weight of 513.42 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111806327 |
| Molecular Formula | C22H32IN3O3 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCCc2ccc(OCC(C)C)cc2)cc1OC.I |
| InChI | InChI=1S/C22H31N3O3.HI/c1-16(2)15-28-19-8-5-17(6-9-19)11-12-24-22(23)25-14-18-7-10-20(26-3)21(13-18)27-4;/h5-10,13,16H,11-12,14-15H2,1-4H3,(H3,23,24,25);1H |
| InChIKey | SAPNMIZDRSPXGF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|