C16H26IN3O4 — CID 111806509
N'-[2-(2,4,6-trimethoxyphenyl)ethyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111806509) has the molecular formula C16H26IN3O4 and a molecular weight of 451.31 g/mol. Its IUPAC name is N'-[2-(2,4,6-trimethoxyphenyl)ethyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,4,6-trimethoxyphenyl)ethyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111806509 |
| Molecular Formula | C16H26IN3O4 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N'-[2-(2,4,6-trimethoxyphenyl)ethyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | COc1cc(OC)c(CC/N=C(\N)N2CCOCC2)c(OC)c1.I |
| InChI | InChI=1S/C16H25N3O4.HI/c1-20-12-10-14(21-2)13(15(11-12)22-3)4-5-18-16(17)19-6-8-23-9-7-19;/h10-11H,4-9H2,1-3H3,(H2,17,18);1H |
| InChIKey | FPGKVCCUDKCGFK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|