C31H51NO7Si — CID 11180704
(4S,5R)-3-[(2S)-3-[(4R,5R)-5-[(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 11180704) has the molecular formula C31H51NO7Si and a molecular weight of 577.84 g/mol. Its IUPAC name is (4S,5R)-3-[(2S)-3-[(4R,5R)-5-[(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2S)-3-[(4R,5R)-5-[(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11180704 |
| Molecular Formula | C31H51NO7Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | (4S,5R)-3-[(2S)-3-[(4R,5R)-5-[(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CCC[C@@]1(C)OC(C)(C)O[C@@H]1C[C@H](O)C(=O)N1C(=O)O[C@H](c2ccccc2)[C@@H]1C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H51NO7Si/c1-21(20-36-40(9,10)29(3,4)5)15-14-18-31(8)25(38-30(6,7)39-31)19-24(33)27(34)32-22(2)26(37-28(32)35)23-16-12-11-13-17-23/h11-13,16-17,21-22,24-26,33H,14-15,18-20H2,1-10H3/t21-,22-,24-,25+,26-,31+/m0/s1 |
| InChIKey | FJSXCVJCMGLCCY-JQSVVPPESA-N |
| XLogP | 6.58 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|