C32H29F3N2O3S — CID 11180711
5-[5-[[4-(2-phenylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]pentanoic acid (PubChem CID 11180711) has the molecular formula C32H29F3N2O3S and a molecular weight of 578.66 g/mol. Its IUPAC name is 5-[5-[[4-(2-phenylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]pentanoic acid.
| Compound Name | 5-[5-[[4-(2-phenylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 11180711 |
| Molecular Formula | C32H29F3N2O3S |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 5-[5-[[4-(2-phenylethyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]indol-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1ccc2cc(OCc3sc(-c4ccc(C(F)(F)F)cc4)nc3CCc3ccccc3)ccc21 |
| InChI | InChI=1S/C32H29F3N2O3S/c33-32(34,35)25-12-10-23(11-13-25)31-36-27(15-9-22-6-2-1-3-7-22)29(41-31)21-40-26-14-16-28-24(20-26)17-19-37(28)18-5-4-8-30(38)39/h1-3,6-7,10-14,16-17,19-20H,4-5,8-9,15,18,21H2,(H,38,39) |
| InChIKey | UBLWMEUKASUCBB-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|