C34H44O8 — CID 11180737
(3,4,5-trimethoxyphenyl) (E)-3-[(1S,2R,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-yl]-2-methylprop-2-enoate (PubChem CID 11180737) has the molecular formula C34H44O8 and a molecular weight of 580.72 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) (E)-3-[(1S,2R,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-yl]-2-methylprop-2-enoate.
| Compound Name | (3,4,5-trimethoxyphenyl) (E)-3-[(1S,2R,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11180737 |
| Molecular Formula | C34H44O8 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) (E)-3-[(1S,2R,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-yl]-2-methylprop-2-enoate |
| SMILES | COc1cc(OC(=O)/C(C)=C/[C@H]2CC[C@@H]3[C@@]4(C)C(=O)C=CC(C)(C)C4CC[C@@]3(C)[C@@]23COC(=O)C3)cc(OC)c1OC |
| InChI | InChI=1S/C34H44O8/c1-20(30(37)42-22-16-23(38-6)29(40-8)24(17-22)39-7)15-21-9-10-26-32(4,34(21)18-28(36)41-19-34)14-11-25-31(2,3)13-12-27(35)33(25,26)5/h12-13,15-17,21,25-26H,9-11,14,18-19H2,1-8H3/b20-15+/t21-,25?,26+,32-,33+,34+/m1/s1 |
| InChIKey | XJWIWOXZERVBBP-MQYRRNNCSA-N |
| XLogP | 6.11 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|