C19H29N7S2 — CID 111808278
N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111808278) has the molecular formula C19H29N7S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111808278 |
| Molecular Formula | C19H29N7S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | Cc1nc(CN2CCC(C/N=C(\N)N3CCN(c4nccs4)CC3)CC2)cs1 |
| InChI | InChI=1S/C19H29N7S2/c1-15-23-17(14-28-15)13-24-5-2-16(3-6-24)12-22-18(20)25-7-9-26(10-8-25)19-21-4-11-27-19/h4,11,14,16H,2-3,5-10,12-13H2,1H3,(H2,20,22) |
| InChIKey | LGWVYCIOQMLRMJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|