C34H44O9 — CID 11180916
[(1R,3S,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate (PubChem CID 11180916) has the molecular formula C34H44O9 and a molecular weight of 596.72 g/mol. Its IUPAC name is [(1R,3S,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate.
| Compound Name | [(1R,3S,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate |
|---|---|
| PubChem CID | 11180916 |
| Molecular Formula | C34H44O9 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | [(1R,3S,5R,6S,8R,10S,12R,13S)-13-acetyloxy-3-methyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2C[C@H]3O[C@@H](CCOCc4ccccc4)[C@H](OCc4ccccc4)C[C@]3(C)O[C@@H]2CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H44O9/c1-23(35)38-22-32-27(40-24(2)36)14-15-29-30(41-32)18-33-34(3,43-29)19-31(39-21-26-12-8-5-9-13-26)28(42-33)16-17-37-20-25-10-6-4-7-11-25/h4-13,27-33H,14-22H2,1-3H3/t27-,28-,29+,30-,31+,32+,33+,34-/m0/s1 |
| InChIKey | OCMDRJIWVJPFMT-OFQJRSHVSA-N |
| XLogP | 4.93 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|