C11H22IN5O — CID 111809405
1-propan-2-yl-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111809405) has the molecular formula C11H22IN5O and a molecular weight of 367.24 g/mol. Its IUPAC name is 1-propan-2-yl-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-propan-2-yl-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111809405 |
| Molecular Formula | C11H22IN5O |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-propan-2-yl-2-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/CCc1nc(C(C)C)no1.I |
| InChI | InChI=1S/C11H21N5O.HI/c1-7(2)10-15-9(17-16-10)5-6-13-11(12)14-8(3)4;/h7-8H,5-6H2,1-4H3,(H3,12,13,14);1H |
| InChIKey | AWMOHQPOJCPZGV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|