C19H23F3N4O — CID 111810310
2-[2-[benzyl(methyl)amino]propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111810310) has the molecular formula C19H23F3N4O and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-[2-[benzyl(methyl)amino]propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[2-[benzyl(methyl)amino]propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111810310 |
| Molecular Formula | C19H23F3N4O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[2-[benzyl(methyl)amino]propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CC(C/N=C(\N)Nc1ccc(OC(F)(F)F)cc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H23F3N4O/c1-14(26(2)13-15-6-4-3-5-7-15)12-24-18(23)25-16-8-10-17(11-9-16)27-19(20,21)22/h3-11,14H,12-13H2,1-2H3,(H3,23,24,25) |
| InChIKey | AOXNKOKOMNBGRY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|