C16H34IN3O3 — CID 111811333
tert-butyl 7-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]heptanoate;hydroiodide (PubChem CID 111811333) has the molecular formula C16H34IN3O3 and a molecular weight of 443.37 g/mol. Its IUPAC name is tert-butyl 7-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]heptanoate;hydroiodide.
| Compound Name | tert-butyl 7-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111811333 |
| Molecular Formula | C16H34IN3O3 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | tert-butyl 7-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]heptanoate;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CCCCCCC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H33N3O3.HI/c1-13(12-21-5)19-15(17)18-11-9-7-6-8-10-14(20)22-16(2,3)4;/h13H,6-12H2,1-5H3,(H3,17,18,19);1H |
| InChIKey | DDYHLCKJYDXAQJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|