C26H36F6N4O7 — CID 11181181
N-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]piperazine-1-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 11181181) has the molecular formula C26H36F6N4O7 and a molecular weight of 630.58 g/mol. Its IUPAC name is N-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]piperazine-1-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]piperazine-1-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 11181181 |
| Molecular Formula | C26H36F6N4O7 |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | N-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]piperazine-1-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)N4CCNCC4)C[C@@H]2N(C)CC3)cc1OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H34N4O3.2C2HF3O2/c1-25-11-8-22(16-4-5-18(28-2)19(14-16)29-3)7-6-17(15-20(22)25)24-21(27)26-12-9-23-10-13-26;2*3-2(4,5)1(6)7/h4-5,14,17,20,23H,6-13,15H2,1-3H3,(H,24,27);2*(H,6,7)/t17-,20+,22+;;/m1../s1 |
| InChIKey | HXLRLXXNBUJUON-PFNBTUFDSA-N |
| XLogP | 3.08 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |