C34H34N2O10 — CID 11181184
[(2R,3R,4R,5R)-4-acetyloxy-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 11181184) has the molecular formula C34H34N2O10 and a molecular weight of 630.65 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11181184 |
| Molecular Formula | C34H34N2O10 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H34N2O10/c1-21(37)44-30-28(46-32(31(30)45-22(2)38)36-19-18-29(39)35-33(36)40)20-43-34(23-8-6-5-7-9-23,24-10-14-26(41-3)15-11-24)25-12-16-27(42-4)17-13-25/h5-19,28,30-32H,20H2,1-4H3,(H,35,39,40)/t28-,30-,31-,32-/m1/s1 |
| InChIKey | ROCOYRMZDBRGQZ-PYTKSMOKSA-N |
| XLogP | 3.32 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|