C32H42N6O8 — CID 11181239
3-[4,8-bis[(3,4-dimethoxyphenyl)methyl-methylamino]-2-(3-hydroxypropoxy)pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol (PubChem CID 11181239) has the molecular formula C32H42N6O8 and a molecular weight of 638.72 g/mol. Its IUPAC name is 3-[4,8-bis[(3,4-dimethoxyphenyl)methyl-methylamino]-2-(3-hydroxypropoxy)pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol.
| Compound Name | 3-[4,8-bis[(3,4-dimethoxyphenyl)methyl-methylamino]-2-(3-hydroxypropoxy)pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 11181239 |
| Molecular Formula | C32H42N6O8 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 3-[4,8-bis[(3,4-dimethoxyphenyl)methyl-methylamino]-2-(3-hydroxypropoxy)pyrimido[5,4-d]pyrimidin-6-yl]oxypropan-1-ol |
| SMILES | COc1ccc(CN(C)c2nc(OCCCO)nc3c(N(C)Cc4ccc(OC)c(OC)c4)nc(OCCCO)nc23)cc1OC |
| InChI | InChI=1S/C32H42N6O8/c1-37(19-21-9-11-23(41-3)25(17-21)43-5)29-27-28(34-31(35-29)45-15-7-13-39)30(36-32(33-27)46-16-8-14-40)38(2)20-22-10-12-24(42-4)26(18-22)44-6/h9-12,17-18,39-40H,7-8,13-16,19-20H2,1-6H3 |
| InChIKey | GLCBAPORWWKQQY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|