C13H22IN3O2 — CID 111813379
1-tert-butyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111813379) has the molecular formula C13H22IN3O2 and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-tert-butyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813379 |
| Molecular Formula | C13H22IN3O2 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-tert-butyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(O)c(C/N=C(\N)NC(C)(C)C)c1.I |
| InChI | InChI=1S/C13H21N3O2.HI/c1-13(2,3)16-12(14)15-8-9-7-10(18-4)5-6-11(9)17;/h5-7,17H,8H2,1-4H3,(H3,14,15,16);1H |
| InChIKey | JLOOWPJDFUIBNR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|