C21H31Cl3INO4SSi — CID 11181340
[4-[(1E,3S,5Z)-6-iodo-2-methyl-3-triethylsilyloxyhepta-1,5-dienyl]-1,3-thiazol-2-yl]methyl 2,2,2-trichloroethyl carbonate (PubChem CID 11181340) has the molecular formula C21H31Cl3INO4SSi and a molecular weight of 654.90 g/mol. Its IUPAC name is [4-[(1E,3S,5Z)-6-iodo-2-methyl-3-triethylsilyloxyhepta-1,5-dienyl]-1,3-thiazol-2-yl]methyl 2,2,2-trichloroethyl carbonate.
| Compound Name | [4-[(1E,3S,5Z)-6-iodo-2-methyl-3-triethylsilyloxyhepta-1,5-dienyl]-1,3-thiazol-2-yl]methyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 11181340 |
| Molecular Formula | C21H31Cl3INO4SSi |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 652.99 |
| IUPAC Name | [4-[(1E,3S,5Z)-6-iodo-2-methyl-3-triethylsilyloxyhepta-1,5-dienyl]-1,3-thiazol-2-yl]methyl 2,2,2-trichloroethyl carbonate |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C=C(/C)I)/C(C)=C/c1csc(COC(=O)OCC(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C21H31Cl3INO4SSi/c1-6-32(7-2,8-3)30-18(10-9-16(5)25)15(4)11-17-13-31-19(26-17)12-28-20(27)29-14-21(22,23)24/h9,11,13,18H,6-8,10,12,14H2,1-5H3/b15-11+,16-9-/t18-/m0/s1 |
| InChIKey | XLHBQYJDSAICAN-PYVJFZFNSA-N |
| XLogP | 8.69 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|