C46H32N4O2 — CID 11181451
methyl 4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)benzoate (PubChem CID 11181451) has the molecular formula C46H32N4O2 and a molecular weight of 672.79 g/mol. Its IUPAC name is methyl 4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)benzoate.
| Compound Name | methyl 4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)benzoate |
|---|---|
| PubChem CID | 11181451 |
| Molecular Formula | C46H32N4O2 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | methyl 4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H32N4O2/c1-52-46(51)33-19-17-32(18-20-33)45-40-27-25-38(49-40)43(30-13-7-3-8-14-30)36-23-21-34(47-36)42(29-11-5-2-6-12-29)35-22-24-37(48-35)44(31-15-9-4-10-16-31)39-26-28-41(45)50-39/h2-28,47-48H,1H3/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | JYTWPMXQCKOXJN-HIXPDHBDSA-N |
| XLogP | 11.11 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |