C28H30N2P2 — CID 11181471
N,N'-bis(diphenylphosphanyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 11181471) has the molecular formula C28H30N2P2 and a molecular weight of 456.51 g/mol. Its IUPAC name is N,N'-bis(diphenylphosphanyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis(diphenylphosphanyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 11181471 |
| Molecular Formula | C28H30N2P2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N,N'-bis(diphenylphosphanyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2P2/c1-29(31(25-15-7-3-8-16-25)26-17-9-4-10-18-26)23-24-30(2)32(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22H,23-24H2,1-2H3 |
| InChIKey | IHWJVPIVZJQJAJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|