C15H16F3IN4OS — CID 111815201
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111815201) has the molecular formula C15H16F3IN4OS and a molecular weight of 484.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111815201 |
| Molecular Formula | C15H16F3IN4OS |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nc(C(F)(F)F)cs1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C15H15F3N4OS.HI/c16-15(17,18)12-8-24-13(22-12)7-20-14(19)21-10-5-6-23-11-4-2-1-3-9(10)11;/h1-4,8,10H,5-7H2,(H3,19,20,21);1H |
| InChIKey | DUEGSXYKMDBQGV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|