About 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine
2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine (PubChem CID 111815626) has the molecular formula C17H33N3O
and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine |
| PubChem CID | 111815626 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/C1C2CCOC2C1(C)C |
| InChI | InChI=1S/C17H33N3O/c1-11(2)7-6-8-12(3)19-16(18)20-14-13-9-10-21-15(13)17(14,4)5/h11-15H,6-10H2,1-5H3,(H3,18,19,20) |
| InChIKey | GFWQASPFWQETEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine?
The IUPAC name of 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine (CID 111815626) is 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine.
What is the SMILES notation for 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine?
The canonical SMILES for 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine is CC(C)CCCC(C)N/C(N)=N/C1C2CCOC2C1(C)C.
What is the InChIKey of 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine?
The InChIKey is GFWQASPFWQETEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O/c1-11(2)7-6-8-12(3)19-16(18)20-14-13-9-10-21-15(13)17(14,4)5/h11-15H,6-10H2,1-5H3,(H3,18,19,20).
What are the key properties of 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine?
2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine has a molecular weight of 295.47 g/mol, XLogP of 2.92, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-(6-methylheptan-2-yl)guanidine is sourced from PubChem (CID 111815626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).