C17H26IN5 — CID 111815931
1-hexyl-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111815931) has the molecular formula C17H26IN5 and a molecular weight of 427.33 g/mol. Its IUPAC name is 1-hexyl-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-hexyl-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111815931 |
| Molecular Formula | C17H26IN5 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-hexyl-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCCCCCN/C(N)=N/Cc1cccc(-n2cccn2)c1.I |
| InChI | InChI=1S/C17H25N5.HI/c1-2-3-4-5-10-19-17(18)20-14-15-8-6-9-16(13-15)22-12-7-11-21-22;/h6-9,11-13H,2-5,10,14H2,1H3,(H3,18,19,20);1H |
| InChIKey | ITYTWTJHCIDXDK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|