About 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide
1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111816527) has the molecular formula C10H24IN3S
and a molecular weight of 345.29 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| PubChem CID | 111816527 |
| Molecular Formula | C10H24IN3S |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CSCCCCN=C(N(C)C)N(C)C.I |
| InChI | InChI=1S/C10H23N3S.HI/c1-12(2)10(13(3)4)11-8-6-7-9-14-5;/h6-9H2,1-5H3;1H |
| InChIKey | HZAYTIQZXOSFCH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide?
The IUPAC name of 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide (CID 111816527) is 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide.
What is the SMILES notation for 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide?
The canonical SMILES for 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide is CSCCCCN=C(N(C)C)N(C)C.I.
What is the InChIKey of 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide?
The InChIKey is HZAYTIQZXOSFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3S.HI/c1-12(2)10(13(3)4)11-8-6-7-9-14-5;/h6-9H2,1-5H3;1H.
What are the key properties of 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide?
1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide has a molecular weight of 345.29 g/mol, XLogP of 2.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-tetramethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide is sourced from PubChem (CID 111816527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).