C28H38I2O4Si — CID 11181684
[(2R,3R,5S,6aS,8R,9aS)-5,8-bis(iodomethyl)-2,3-diphenyl-3,5,6,7,8,9a-hexahydro-2H-furo[2,3-e][1,4]dioxocin-6a-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11181684) has the molecular formula C28H38I2O4Si and a molecular weight of 720.50 g/mol. Its IUPAC name is [(2R,3R,5S,6aS,8R,9aS)-5,8-bis(iodomethyl)-2,3-diphenyl-3,5,6,7,8,9a-hexahydro-2H-furo[2,3-e][1,4]dioxocin-6a-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,5S,6aS,8R,9aS)-5,8-bis(iodomethyl)-2,3-diphenyl-3,5,6,7,8,9a-hexahydro-2H-furo[2,3-e][1,4]dioxocin-6a-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11181684 |
| Molecular Formula | C28H38I2O4Si |
| Molecular Weight | 720.50 g/mol |
| Exact Mass | 720.06 |
| IUPAC Name | [(2R,3R,5S,6aS,8R,9aS)-5,8-bis(iodomethyl)-2,3-diphenyl-3,5,6,7,8,9a-hexahydro-2H-furo[2,3-e][1,4]dioxocin-6a-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12C[C@H](CI)O[C@@H]1O[C@H](c1ccccc1)[C@@H](c1ccccc1)O[C@H](CI)C2 |
| InChI | InChI=1S/C28H38I2O4Si/c1-27(2,3)35(4,5)34-28-16-22(18-29)31-24(20-12-8-6-9-13-20)25(21-14-10-7-11-15-21)33-26(28)32-23(17-28)19-30/h6-15,22-26H,16-19H2,1-5H3/t22-,23+,24+,25+,26+,28-/m0/s1 |
| InChIKey | PWUKBJKKKQSLIW-LJXJJVDOSA-N |
| XLogP | 8.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.50 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|