About N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide
N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide (PubChem CID 111817356) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide |
| PubChem CID | 111817356 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide |
| SMILES | Cc1nc(C/N=C(\N)N2CCOCC2)sc1C |
| InChI | InChI=1S/C11H18N4OS/c1-8-9(2)17-10(14-8)7-13-11(12)15-3-5-16-6-4-15/h3-7H2,1-2H3,(H2,12,13) |
| InChIKey | XFQSCVWKTAMURO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide?
The IUPAC name of N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide (CID 111817356) is N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide.
What is the SMILES notation for N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide?
The canonical SMILES for N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide is Cc1nc(C/N=C(\N)N2CCOCC2)sc1C.
What is the InChIKey of N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide?
The InChIKey is XFQSCVWKTAMURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c1-8-9(2)17-10(14-8)7-13-11(12)15-3-5-16-6-4-15/h3-7H2,1-2H3,(H2,12,13).
What are the key properties of N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide?
N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide has a molecular weight of 254.36 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide is sourced from PubChem (CID 111817356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).