About bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium
bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium (PubChem CID 11181779) has the molecular formula C34H68F6N2O4S2
and a molecular weight of 747.05 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium |
| PubChem CID | 11181779 |
| Molecular Formula | C34H68F6N2O4S2 |
| Molecular Weight | 747.05 g/mol |
| Exact Mass | 746.45 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C32H68N.C2F6NO4S2/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-32H2,1-4H3;/q+1;-1 |
| InChIKey | RNNKOIIZECPRKX-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 747.05 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium (CID 11181779) is bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium is CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium?
The InChIKey is RNNKOIIZECPRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H68N.C2F6NO4S2/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-32H2,1-4H3;/q+1;-1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium?
bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium has a molecular weight of 747.05 g/mol, XLogP of 12.30, 30 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;tetraoctylazanium is sourced from PubChem (CID 11181779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).