C32H50O18Si — CID 11181794
[(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 11181794) has the molecular formula C32H50O18Si and a molecular weight of 750.82 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11181794 |
| Molecular Formula | C32H50O18Si |
| Molecular Weight | 750.82 g/mol |
| Exact Mass | 750.28 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H50O18Si/c1-15(33)40-13-22-25(27(44-18(4)36)28(45-19(5)37)30(48-22)47-21(7)39)50-31-29(46-20(6)38)26(43-17(3)35)24(42-16(2)34)23(49-31)14-41-51(11,12)32(8,9)10/h22-31H,13-14H2,1-12H3/t22-,23-,24+,25-,26+,27+,28+,29-,30+,31+/m1/s1 |
| InChIKey | OYGBXVKICOCRSB-HXFZIAGASA-N |
| XLogP | 1.63 |
| TPSA | 221.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.82 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|