C18H23FIN3O — CID 111820505
1-(3,5-dimethylphenyl)-2-[2-(3-fluorophenoxy)propyl]guanidine;hydroiodide (PubChem CID 111820505) has the molecular formula C18H23FIN3O and a molecular weight of 443.30 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[2-(3-fluorophenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[2-(3-fluorophenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111820505 |
| Molecular Formula | C18H23FIN3O |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[2-(3-fluorophenoxy)propyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC(C)Oc2cccc(F)c2)c1.I |
| InChI | InChI=1S/C18H22FN3O.HI/c1-12-7-13(2)9-16(8-12)22-18(20)21-11-14(3)23-17-6-4-5-15(19)10-17;/h4-10,14H,11H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | PTLLSWAMFKDCEC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|