C34H48O2 — CID 11182214
[2,6-di(propan-2-yl)phenyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 11182214) has the molecular formula C34H48O2 and a molecular weight of 488.76 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 11182214 |
| Molecular Formula | C34H48O2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C34H48O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28-33(35)36-34-31(29(2)3)26-25-27-32(34)30(4)5/h7-8,10-11,13-14,16-17,19-20,22-23,25-27,29-30H,6,9,12,15,18,21,24,28H2,1-5H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | CHIRWFQKAWHTEA-XTJKPUCJSA-N |
| XLogP | 10.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|