C15H18ClN3OS — CID 111822256
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 111822256) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111822256 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC(O)c2ccc(Cl)s2)cc1C |
| InChI | InChI=1S/C15H18ClN3OS/c1-9-3-4-11(7-10(9)2)19-15(17)18-8-12(20)13-5-6-14(16)21-13/h3-7,12,20H,8H2,1-2H3,(H3,17,18,19) |
| InChIKey | UQQCBYNBEMPJBH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|