C16H26ClN3O2 — CID 111822869
1-(3-chloro-4-methoxyphenyl)-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine (PubChem CID 111822869) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
|---|---|
| PubChem CID | 111822869 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC(CCO)CC(C)C)cc1Cl |
| InChI | InChI=1S/C16H26ClN3O2/c1-11(2)8-12(6-7-21)10-19-16(18)20-13-4-5-15(22-3)14(17)9-13/h4-5,9,11-12,21H,6-8,10H2,1-3H3,(H3,18,19,20) |
| InChIKey | JBFAVENDXRWRLX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|