C15H18F3N3 — CID 111823171
1,1,3,3-tetramethyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111823171) has the molecular formula C15H18F3N3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111823171 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | CN(C)C(=NCC#Cc1ccc(C(F)(F)F)cc1)N(C)C |
| InChI | InChI=1S/C15H18F3N3/c1-20(2)14(21(3)4)19-11-5-6-12-7-9-13(10-8-12)15(16,17)18/h7-10H,11H2,1-4H3 |
| InChIKey | BXCOOJSAUFQEIH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|