About 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine
2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine (PubChem CID 111823349) has the molecular formula C12H21N7
and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine.
Molecular Properties
| Compound Name | 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine |
| PubChem CID | 111823349 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCCc1[nH]nc(N)c1C#N |
| InChI | InChI=1S/C12H21N7/c1-3-19(4-2)12(15)16-7-5-6-10-9(8-13)11(14)18-17-10/h3-7H2,1-2H3,(H2,15,16)(H3,14,17,18) |
| InChIKey | TWSZDIXHPYNOET-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine?
The IUPAC name of 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine (CID 111823349) is 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine.
What is the SMILES notation for 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine?
The canonical SMILES for 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine is CCN(CC)/C(N)=N/CCCc1[nH]nc(N)c1C#N.
What is the InChIKey of 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine?
The InChIKey is TWSZDIXHPYNOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N7/c1-3-19(4-2)12(15)16-7-5-6-10-9(8-13)11(14)18-17-10/h3-7H2,1-2H3,(H2,15,16)(H3,14,17,18).
What are the key properties of 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine?
2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine has a molecular weight of 263.35 g/mol, XLogP of 0.45, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1,1-diethylguanidine is sourced from PubChem (CID 111823349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).