C22H32FN7 — CID 111823377
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(6-methylheptan-2-yl)guanidine (PubChem CID 111823377) has the molecular formula C22H32FN7 and a molecular weight of 413.55 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(6-methylheptan-2-yl)guanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111823377 |
| Molecular Formula | C22H32FN7 |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(6-methylheptan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C22H32FN7/c1-15(2)6-4-7-16(3)28-22(26)27-13-5-8-20-19(14-24)21(25)30(29-20)18-11-9-17(23)10-12-18/h9-12,15-16H,4-8,13,25H2,1-3H3,(H3,26,27,28) |
| InChIKey | AHKUDMJPJGPPCN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|