C11H21N5O3S — CID 111824522
1,1,3,3-tetramethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine (PubChem CID 111824522) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 111824522 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine |
| SMILES | CN(C)C(=NCCNS(=O)(=O)Cc1ccon1)N(C)C |
| InChI | InChI=1S/C11H21N5O3S/c1-15(2)11(16(3)4)12-6-7-13-20(17,18)9-10-5-8-19-14-10/h5,8,13H,6-7,9H2,1-4H3 |
| InChIKey | RFLGRXACBNKUSI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|