C16H22ClNO3 — CID 111824912
3-[(6-chloro-2H-chromen-3-yl)methylamino]-4-methoxy-3-methylbutan-1-ol (PubChem CID 111824912) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-[(6-chloro-2H-chromen-3-yl)methylamino]-4-methoxy-3-methylbutan-1-ol.
| Compound Name | 3-[(6-chloro-2H-chromen-3-yl)methylamino]-4-methoxy-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 111824912 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[(6-chloro-2H-chromen-3-yl)methylamino]-4-methoxy-3-methylbutan-1-ol |
| SMILES | COCC(C)(CCO)NCC1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C16H22ClNO3/c1-16(5-6-19,11-20-2)18-9-12-7-13-8-14(17)3-4-15(13)21-10-12/h3-4,7-8,18-19H,5-6,9-11H2,1-2H3 |
| InChIKey | VJIRJCNZCQLLMV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |