C19H19F2NO3 — CID 111825354
(E)-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(3-fluorophenyl)but-3-enamide (PubChem CID 111825354) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is (E)-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(3-fluorophenyl)but-3-enamide.
| Compound Name | (E)-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(3-fluorophenyl)but-3-enamide |
|---|---|
| PubChem CID | 111825354 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (E)-N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(3-fluorophenyl)but-3-enamide |
| SMILES | O=C(C/C=C/c1cccc(F)c1)NCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2NO3/c20-15-7-9-18(10-8-15)25-13-17(23)12-22-19(24)6-2-4-14-3-1-5-16(21)11-14/h1-5,7-11,17,23H,6,12-13H2,(H,22,24)/b4-2+ |
| InChIKey | NMHIEPRSLGESMF-DUXPYHPUSA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |