About N-ethenylprop-2-enamide
N-ethenylprop-2-enamide (PubChem CID 11182574) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is N-ethenylprop-2-enamide.
Molecular Properties
| Compound Name | N-ethenylprop-2-enamide |
| PubChem CID | 11182574 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | N-ethenylprop-2-enamide |
| SMILES | C=CNC(=O)C=C |
| InChI | InChI=1S/C5H7NO/c1-3-5(7)6-4-2/h3-4H,1-2H2,(H,6,7) |
| InChIKey | ILCQQHAOOOVHQJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylprop-2-enamide?
The IUPAC name of N-ethenylprop-2-enamide (CID 11182574) is N-ethenylprop-2-enamide.
What is the SMILES notation for N-ethenylprop-2-enamide?
The canonical SMILES for N-ethenylprop-2-enamide is C=CNC(=O)C=C.
What is the InChIKey of N-ethenylprop-2-enamide?
The InChIKey is ILCQQHAOOOVHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO/c1-3-5(7)6-4-2/h3-4H,1-2H2,(H,6,7).
What are the key properties of N-ethenylprop-2-enamide?
N-ethenylprop-2-enamide has a molecular weight of 97.12 g/mol, XLogP of 0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylprop-2-enamide is sourced from PubChem (CID 11182574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).