About methyl (2R)-2-aminopropanoate;hydrochloride
methyl (2R)-2-aminopropanoate;hydrochloride (PubChem CID 11182647) has the molecular formula C4H10ClNO2
and a molecular weight of 139.58 g/mol. Its IUPAC name is methyl (2R)-2-aminopropanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl (2R)-2-aminopropanoate;hydrochloride |
| PubChem CID | 11182647 |
| Molecular Formula | C4H10ClNO2 |
| Molecular Weight | 139.58 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | methyl (2R)-2-aminopropanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](C)N.Cl |
| InChI | InChI=1S/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H/t3-;/m1./s1 |
| InChIKey | IYUKFAFDFHZKPI-AENDTGMFSA-N |
| XLogP | -0.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.58 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-2-aminopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-aminopropanoate;hydrochloride?
The IUPAC name of methyl (2R)-2-aminopropanoate;hydrochloride (CID 11182647) is methyl (2R)-2-aminopropanoate;hydrochloride.
What is the SMILES notation for methyl (2R)-2-aminopropanoate;hydrochloride?
The canonical SMILES for methyl (2R)-2-aminopropanoate;hydrochloride is COC(=O)[C@@H](C)N.Cl.
What is the InChIKey of methyl (2R)-2-aminopropanoate;hydrochloride?
The InChIKey is IYUKFAFDFHZKPI-AENDTGMFSA-N. The full InChI is InChI=1S/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H/t3-;/m1./s1.
What are the key properties of methyl (2R)-2-aminopropanoate;hydrochloride?
methyl (2R)-2-aminopropanoate;hydrochloride has a molecular weight of 139.58 g/mol, XLogP of -0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-aminopropanoate;hydrochloride is sourced from PubChem (CID 11182647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).