C8H15NO — CID 11182655
(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol (PubChem CID 11182655) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol.
| Compound Name | (1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol |
|---|---|
| PubChem CID | 11182655 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol |
| SMILES | O[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C8H15NO/c10-8-4-6-9-5-2-1-3-7(8)9/h7-8,10H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | IATZHJGSCGLJSL-JGVFFNPUSA-N |
| XLogP | 0.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |