2-amino-4-hydroxybenzoic acid

C7H7NO3 — CID 11182709

IUPAC2-amino-4-hydroxybenzoic acid
SMILESNc1cc(O)ccc1C(=O)O
InChIInChI=1S/C7H7NO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,8H2,(H,10,11)
InChIKeyDPELYVFAULJYNX-UHFFFAOYSA-N
MW153.14 g/mol
LogP0.67
Rot. Bonds1

About 2-amino-4-hydroxybenzoic acid

2-amino-4-hydroxybenzoic acid (PubChem CID 11182709) has the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. Its IUPAC name is 2-amino-4-hydroxybenzoic acid.

Molecular Properties

Compound Name2-amino-4-hydroxybenzoic acid
PubChem CID11182709
Molecular FormulaC7H7NO3
Molecular Weight153.14 g/mol
Exact Mass153.04
IUPAC Name2-amino-4-hydroxybenzoic acid
SMILESNc1cc(O)ccc1C(=O)O
InChIInChI=1S/C7H7NO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,8H2,(H,10,11)
InChIKeyDPELYVFAULJYNX-UHFFFAOYSA-N
XLogP0.67
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.14
LogP ≤ 50.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-4-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-hydroxybenzoic acid?
The IUPAC name of 2-amino-4-hydroxybenzoic acid (CID 11182709) is 2-amino-4-hydroxybenzoic acid.
What is the SMILES notation for 2-amino-4-hydroxybenzoic acid?
The canonical SMILES for 2-amino-4-hydroxybenzoic acid is Nc1cc(O)ccc1C(=O)O.
What is the InChIKey of 2-amino-4-hydroxybenzoic acid?
The InChIKey is DPELYVFAULJYNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,8H2,(H,10,11).
What are the key properties of 2-amino-4-hydroxybenzoic acid?
2-amino-4-hydroxybenzoic acid has a molecular weight of 153.14 g/mol, XLogP of 0.67, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-hydroxybenzoic acid is sourced from PubChem (CID 11182709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).