C11H16O — CID 11182804
(6S)-9-methyl-1-oxaspiro[5.5]undeca-3,9-diene (PubChem CID 11182804) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (6S)-9-methyl-1-oxaspiro[5.5]undeca-3,9-diene.
| Compound Name | (6S)-9-methyl-1-oxaspiro[5.5]undeca-3,9-diene |
|---|---|
| PubChem CID | 11182804 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (6S)-9-methyl-1-oxaspiro[5.5]undeca-3,9-diene |
| SMILES | CC1=CC[C@@]2(CC=CCO2)CC1 |
| InChI | InChI=1S/C11H16O/c1-10-4-7-11(8-5-10)6-2-3-9-12-11/h2-4H,5-9H2,1H3/t11-/m0/s1 |
| InChIKey | WCNZUWWYBAZDNU-NSHDSACASA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|