C16H35N5O — CID 111829390
1-(3-butoxypropyl)-3-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylguanidine (PubChem CID 111829390) has the molecular formula C16H35N5O and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-(3-butoxypropyl)-3-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111829390 |
| Molecular Formula | C16H35N5O |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCC1CN(C)CCN1C |
| InChI | InChI=1S/C16H35N5O/c1-5-6-11-22-12-7-8-18-16(17-2)19-13-15-14-20(3)9-10-21(15)4/h15H,5-14H2,1-4H3,(H2,17,18,19) |
| InChIKey | ADOWDIMNTLMMDJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|