C11H12O2 — CID 11182942
(1R,8S,9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol (PubChem CID 11182942) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1R,8S,9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol.
| Compound Name | (1R,8S,9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol |
|---|---|
| PubChem CID | 11182942 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1R,8S,9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C11H12O2/c12-10-8-5-9(11(10)13)7-4-2-1-3-6(7)8/h1-4,8-13H,5H2/t8-,9+,10-,11+ |
| InChIKey | KKBAQAHAWLUGNK-DTIDVZRVSA-N |
| XLogP | 0.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |