C18H40N6 — CID 111829506
2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine (PubChem CID 111829506) has the molecular formula C18H40N6 and a molecular weight of 340.56 g/mol. Its IUPAC name is 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine.
| Compound Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111829506 |
| Molecular Formula | C18H40N6 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CN(C)CCN1C)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C18H40N6/c1-8-19-18(20-9-10-24(15(2)3)16(4)5)21-13-17-14-22(6)11-12-23(17)7/h15-17H,8-14H2,1-7H3,(H2,19,20,21) |
| InChIKey | KEXMWDSSSVGFSY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|