C21H33IN4O — CID 111829687
1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide (PubChem CID 111829687) has the molecular formula C21H33IN4O and a molecular weight of 484.43 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111829687 |
| Molecular Formula | C21H33IN4O |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)N1Cc2ccccc2C1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C21H32N4O.HI/c1-16-9-11-19(12-10-16)24-21(22-2)23-13-5-8-20(26)25-14-17-6-3-4-7-18(17)15-25;/h3-4,6-7,16,19H,5,8-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | DHGUCGUAKFUUPV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|