C19H32N6O2S — CID 111830639
ethyl 4-[[N'-methyl-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111830639) has the molecular formula C19H32N6O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-methyl-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111830639 |
| Molecular Formula | C19H32N6O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCc2csc(N3CCCC3)n2)CC1 |
| InChI | InChI=1S/C19H32N6O2S/c1-3-27-19(26)25-12-7-15(8-13-25)22-17(20-2)21-9-6-16-14-28-18(23-16)24-10-4-5-11-24/h14-15H,3-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | LQUBKSNRRIPVDU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|