C19H28N4OS2 — CID 111832195
2-methyl-1-[3-(1-phenylethoxy)propyl]-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111832195) has the molecular formula C19H28N4OS2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-methyl-1-[3-(1-phenylethoxy)propyl]-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 2-methyl-1-[3-(1-phenylethoxy)propyl]-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111832195 |
| Molecular Formula | C19H28N4OS2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-methyl-1-[3-(1-phenylethoxy)propyl]-3-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | C/N=C(/NCCCOC(C)c1ccccc1)NCCCSc1nccs1 |
| InChI | InChI=1S/C19H28N4OS2/c1-16(17-8-4-3-5-9-17)24-13-6-10-21-18(20-2)22-11-7-14-25-19-23-12-15-26-19/h3-5,8-9,12,15-16H,6-7,10-11,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | OGIVAGFSBMXYBT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|