About (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one
(3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one (PubChem CID 11183299) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one.
Molecular Properties
| Compound Name | (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one |
| PubChem CID | 11183299 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one |
| SMILES | CC1(C)OC(=O)C=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H13NO2/c1-12(2)11(13-8-10(14)15-12)9-6-4-3-5-7-9/h3-8,11H,1-2H3/t11-/m1/s1 |
| InChIKey | AISCPSRYGCFAQP-LLVKDONJSA-N |
| XLogP | 2.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one?
The IUPAC name of (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one (CID 11183299) is (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one.
What is the SMILES notation for (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one?
The canonical SMILES for (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one is CC1(C)OC(=O)C=N[C@@H]1c1ccccc1.
What is the InChIKey of (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one?
The InChIKey is AISCPSRYGCFAQP-LLVKDONJSA-N. The full InChI is InChI=1S/C12H13NO2/c1-12(2)11(13-8-10(14)15-12)9-6-4-3-5-7-9/h3-8,11H,1-2H3/t11-/m1/s1.
What are the key properties of (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one?
(3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one has a molecular weight of 203.24 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,2-dimethyl-3-phenyl-3H-1,4-oxazin-6-one is sourced from PubChem (CID 11183299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).