C19H33IN4O3S2 — CID 111833578
1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833578) has the molecular formula C19H33IN4O3S2 and a molecular weight of 556.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833578 |
| Molecular Formula | C19H33IN4O3S2 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 1-ethyl-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCSCC1)NCCc1cc(C)ccc1OC.I |
| InChI | InChI=1S/C19H32N4O3S2.HI/c1-4-20-19(21-8-7-17-15-16(2)5-6-18(17)26-3)22-9-14-28(24,25)23-10-12-27-13-11-23;/h5-6,15H,4,7-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | RPCGCOJJSIVHBJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|